C17H18F3NO — CID 172674959
2-(3-propan-2-ylphenyl)-5-(2,2,2-trifluoroethoxy)aniline (PubChem CID 172674959) has the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-(3-propan-2-ylphenyl)-5-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | 2-(3-propan-2-ylphenyl)-5-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 172674959 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-(3-propan-2-ylphenyl)-5-(2,2,2-trifluoroethoxy)aniline |
| SMILES | CC(C)c1cccc(-c2ccc(OCC(F)(F)F)cc2N)c1 |
| InChI | InChI=1S/C17H18F3NO/c1-11(2)12-4-3-5-13(8-12)15-7-6-14(9-16(15)21)22-10-17(18,19)20/h3-9,11H,10,21H2,1-2H3 |
| InChIKey | GFDUZMZMMIXXME-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|