C12H14BrF3O — CID 64758716
1-(2-bromo-3,3,3-trifluoropropoxy)-3-propan-2-ylbenzene (PubChem CID 64758716) has the molecular formula C12H14BrF3O and a molecular weight of 311.14 g/mol. Its IUPAC name is 1-(2-bromo-3,3,3-trifluoropropoxy)-3-propan-2-ylbenzene.
| Compound Name | 1-(2-bromo-3,3,3-trifluoropropoxy)-3-propan-2-ylbenzene |
|---|---|
| PubChem CID | 64758716 |
| Molecular Formula | C12H14BrF3O |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 1-(2-bromo-3,3,3-trifluoropropoxy)-3-propan-2-ylbenzene |
| SMILES | CC(C)c1cccc(OCC(Br)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14BrF3O/c1-8(2)9-4-3-5-10(6-9)17-7-11(13)12(14,15)16/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | TUICVXUHQGCQPP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|