C11H15N3O — CID 178030390
(3Z)-4-(3-methoxyphenyl)buta-1,3-diene-1,1,4-triamine (PubChem CID 178030390) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is (3Z)-4-(3-methoxyphenyl)buta-1,3-diene-1,1,4-triamine.
| Compound Name | (3Z)-4-(3-methoxyphenyl)buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 178030390 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | (3Z)-4-(3-methoxyphenyl)buta-1,3-diene-1,1,4-triamine |
| SMILES | COc1cccc(/C(N)=C/C=C(N)N)c1 |
| InChI | InChI=1S/C11H15N3O/c1-15-9-4-2-3-8(7-9)10(12)5-6-11(13)14/h2-7H,12-14H2,1H3/b10-5- |
| InChIKey | BKKWECZJQGSYLT-YHYXMXQVSA-N |
| XLogP | 0.75 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|