C12H12ClFN6O — CID 178031123
5-(4-chloro-5-fluoro-6-morpholin-4-ylpyrimidin-2-yl)pyrimidin-2-amine (PubChem CID 178031123) has the molecular formula C12H12ClFN6O and a molecular weight of 310.72 g/mol. Its IUPAC name is 5-(4-chloro-5-fluoro-6-morpholin-4-ylpyrimidin-2-yl)pyrimidin-2-amine.
| Compound Name | 5-(4-chloro-5-fluoro-6-morpholin-4-ylpyrimidin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 178031123 |
| Molecular Formula | C12H12ClFN6O |
| Molecular Weight | 310.72 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-(4-chloro-5-fluoro-6-morpholin-4-ylpyrimidin-2-yl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(Cl)c(F)c(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C12H12ClFN6O/c13-9-8(14)11(20-1-3-21-4-2-20)19-10(18-9)7-5-16-12(15)17-6-7/h5-6H,1-4H2,(H2,15,16,17) |
| InChIKey | OUIOGHDLWUOKHY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.72 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |