C10H12N6O — CID 2816900
2-morpholin-4-ylpyrimido[4,5-d]pyrimidin-5-amine (PubChem CID 2816900) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is 2-morpholin-4-ylpyrimido[4,5-d]pyrimidin-5-amine.
| Compound Name | 2-morpholin-4-ylpyrimido[4,5-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 2816900 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-morpholin-4-ylpyrimido[4,5-d]pyrimidin-5-amine |
| SMILES | Nc1ncnc2nc(N3CCOCC3)ncc12 |
| InChI | InChI=1S/C10H12N6O/c11-8-7-5-12-10(15-9(7)14-6-13-8)16-1-3-17-4-2-16/h5-6H,1-4H2,(H2,11,12,13,14,15) |
| InChIKey | NVTQTWYSTVDQFX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |