C30H49F3O3 — CID 178033656
[(3R,5R,8R,9S,10S,13R,14S,17R)-17-[(2R)-butan-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl pentanoate (PubChem CID 178033656) has the molecular formula C30H49F3O3 and a molecular weight of 514.71 g/mol. Its IUPAC name is [(3R,5R,8R,9S,10S,13R,14S,17R)-17-[(2R)-butan-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl pentanoate.
| Compound Name | [(3R,5R,8R,9S,10S,13R,14S,17R)-17-[(2R)-butan-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl pentanoate |
|---|---|
| PubChem CID | 178033656 |
| Molecular Formula | C30H49F3O3 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | [(3R,5R,8R,9S,10S,13R,14S,17R)-17-[(2R)-butan-2-yl]-10,13-dimethyl-3-(trifluoromethyl)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxymethyl pentanoate |
| SMILES | CCCCC(=O)OCO[C@]1(C(F)(F)F)CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CC)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H49F3O3/c1-6-8-9-26(34)35-19-36-29(30(31,32)33)17-16-27(4)21(18-29)10-11-22-24-13-12-23(20(3)7-2)28(24,5)15-14-25(22)27/h20-25H,6-19H2,1-5H3/t20-,21-,22+,23-,24+,25+,27+,28-,29-/m1/s1 |
| InChIKey | KAMBWVZJKAABRR-MQKPSIHCSA-N |
| XLogP | 8.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|