C20H16Cl4N2O4 — CID 178034338
[7-chloro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl] N-(2,2,2-trichloroacetyl)carbamate (PubChem CID 178034338) has the molecular formula C20H16Cl4N2O4 and a molecular weight of 490.17 g/mol. Its IUPAC name is [7-chloro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl] N-(2,2,2-trichloroacetyl)carbamate.
| Compound Name | [7-chloro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl] N-(2,2,2-trichloroacetyl)carbamate |
|---|---|
| PubChem CID | 178034338 |
| Molecular Formula | C20H16Cl4N2O4 |
| Molecular Weight | 490.17 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | [7-chloro-2-oxo-1-[(1S)-1-phenylethyl]-3,4-dihydroquinolin-3-yl] N-(2,2,2-trichloroacetyl)carbamate |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)C(OC(=O)NC(=O)C(Cl)(Cl)Cl)Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H16Cl4N2O4/c1-11(12-5-3-2-4-6-12)26-15-10-14(21)8-7-13(15)9-16(17(26)27)30-19(29)25-18(28)20(22,23)24/h2-8,10-11,16H,9H2,1H3,(H,25,28,29)/t11-,16?/m0/s1 |
| InChIKey | GLDZZCOMQNZEKG-CHPOKUKFSA-N |
| XLogP | 4.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.17 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|