C22H24FN2O3+ — CID 178034380
tert-butyl N-[(3R)-6-fluoro-2-oxo-1-(1-phenylethylidene)-3,4-dihydroquinolin-1-ium-3-yl]carbamate (PubChem CID 178034380) has the molecular formula C22H24FN2O3+ and a molecular weight of 383.44 g/mol. Its IUPAC name is tert-butyl N-[(3R)-6-fluoro-2-oxo-1-(1-phenylethylidene)-3,4-dihydroquinolin-1-ium-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-6-fluoro-2-oxo-1-(1-phenylethylidene)-3,4-dihydroquinolin-1-ium-3-yl]carbamate |
|---|---|
| PubChem CID | 178034380 |
| Molecular Formula | C22H24FN2O3+ |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl N-[(3R)-6-fluoro-2-oxo-1-(1-phenylethylidene)-3,4-dihydroquinolin-1-ium-3-yl]carbamate |
| SMILES | C/C(c1ccccc1)=[N+]1/C(=O)[C@H](NC(=O)OC(C)(C)C)Cc2cc(F)ccc21 |
| InChI | InChI=1S/C22H23FN2O3/c1-14(15-8-6-5-7-9-15)25-19-11-10-17(23)12-16(19)13-18(20(25)26)24-21(27)28-22(2,3)4/h5-12,18H,13H2,1-4H3/p+1/b25-14-/t18-/m1/s1 |
| InChIKey | BGTMLDGONLNEPG-DBXOKZBGSA-O |
| XLogP | 3.95 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|