C44H31F6NO3 — CID 178035205
14-[2,6-di(propan-2-yl)phenyl]-10,18-bis[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaene-13,15-dione (PubChem CID 178035205) has the molecular formula C44H31F6NO3 and a molecular weight of 735.72 g/mol. Its IUPAC name is 14-[2,6-di(propan-2-yl)phenyl]-10,18-bis[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaene-13,15-dione.
| Compound Name | 14-[2,6-di(propan-2-yl)phenyl]-10,18-bis[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaene-13,15-dione |
|---|---|
| PubChem CID | 178035205 |
| Molecular Formula | C44H31F6NO3 |
| Molecular Weight | 735.72 g/mol |
| Exact Mass | 735.22 |
| IUPAC Name | 14-[2,6-di(propan-2-yl)phenyl]-10,18-bis[4-(trifluoromethyl)phenyl]-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaene-13,15-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(=O)c2cc(-c3ccc(C(F)(F)F)cc3)c3oc4ccccc4c4c(-c5ccc(C(F)(F)F)cc5)cc(c1=O)c2c34 |
| InChI | InChI=1S/C44H31F6NO3/c1-22(2)28-9-7-10-29(23(3)4)39(28)51-41(52)33-20-31(24-12-16-26(17-13-24)43(45,46)47)36-30-8-5-6-11-35(30)54-40-32(21-34(42(51)53)37(33)38(36)40)25-14-18-27(19-15-25)44(48,49)50/h5-23H,1-4H3 |
| InChIKey | AYJNCUQCHICSGG-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.72 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|