C42H33NO4 — CID 118662656
14-[2,6-di(propan-2-yl)phenyl]-18-phenoxy-10-phenyl-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaene-13,15-dione (PubChem CID 118662656) has the molecular formula C42H33NO4 and a molecular weight of 615.73 g/mol. Its IUPAC name is 14-[2,6-di(propan-2-yl)phenyl]-18-phenoxy-10-phenyl-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaene-13,15-dione.
| Compound Name | 14-[2,6-di(propan-2-yl)phenyl]-18-phenoxy-10-phenyl-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaene-13,15-dione |
|---|---|
| PubChem CID | 118662656 |
| Molecular Formula | C42H33NO4 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 14-[2,6-di(propan-2-yl)phenyl]-18-phenoxy-10-phenyl-8-oxa-14-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(18),2,4,6,9,11,16,19-octaene-13,15-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(=O)c2cc(-c3ccccc3)c3oc4ccccc4c4c(Oc5ccccc5)cc(c1=O)c2c34 |
| InChI | InChI=1S/C42H33NO4/c1-24(2)28-19-13-20-29(25(3)4)39(28)43-41(44)32-22-31(26-14-7-5-8-15-26)40-38-36(32)33(42(43)45)23-35(46-27-16-9-6-10-17-27)37(38)30-18-11-12-21-34(30)47-40/h5-25H,1-4H3 |
| InChIKey | UBILXKQLEBRSJQ-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|