C25H20ClN3O3 — CID 178036574
methyl N-[4-[6-[(4-chlorophenyl)-methylcarbamoyl]isoquinolin-4-yl]phenyl]carbamate (PubChem CID 178036574) has the molecular formula C25H20ClN3O3 and a molecular weight of 445.91 g/mol. Its IUPAC name is methyl N-[4-[6-[(4-chlorophenyl)-methylcarbamoyl]isoquinolin-4-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[6-[(4-chlorophenyl)-methylcarbamoyl]isoquinolin-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 178036574 |
| Molecular Formula | C25H20ClN3O3 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | methyl N-[4-[6-[(4-chlorophenyl)-methylcarbamoyl]isoquinolin-4-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2cncc3ccc(C(=O)N(C)c4ccc(Cl)cc4)cc23)cc1 |
| InChI | InChI=1S/C25H20ClN3O3/c1-29(21-11-7-19(26)8-12-21)24(30)17-3-4-18-14-27-15-23(22(18)13-17)16-5-9-20(10-6-16)28-25(31)32-2/h3-15H,1-2H3,(H,28,31) |
| InChIKey | ZTDMYWSDZQMYLQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |