C22H21ClN3O+ — CID 178039225
[2-[(1R)-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl]-3-cyclopropylbenzoyl]-methyl-methylideneazanium (PubChem CID 178039225) has the molecular formula C22H21ClN3O+ and a molecular weight of 378.88 g/mol. Its IUPAC name is [2-[(1R)-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl]-3-cyclopropylbenzoyl]-methyl-methylideneazanium.
| Compound Name | [2-[(1R)-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl]-3-cyclopropylbenzoyl]-methyl-methylideneazanium |
|---|---|
| PubChem CID | 178039225 |
| Molecular Formula | C22H21ClN3O+ |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [2-[(1R)-7-chloro-2,3-dihydro-1H-pyrrolo[1,2-a]benzimidazol-1-yl]-3-cyclopropylbenzoyl]-methyl-methylideneazanium |
| SMILES | C=[N+](C)C(=O)c1cccc(C2CC2)c1[C@H]1CCc2nc3ccc(Cl)cc3n21 |
| InChI | InChI=1S/C22H21ClN3O/c1-25(2)22(27)16-5-3-4-15(13-6-7-13)21(16)18-10-11-20-24-17-9-8-14(23)12-19(17)26(18)20/h3-5,8-9,12-13,18H,1,6-7,10-11H2,2H3/q+1/t18-/m1/s1 |
| InChIKey | XFZBFEDVWIBZPT-GOSISDBHSA-N |
| XLogP | 4.59 |
| TPSA | 37.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|