About CID 178039441
CID 178039441 (PubChem CID 178039441) has the molecular formula C13H19BN2O
and a molecular weight of 230.12 g/mol.
Molecular Properties
| Compound Name | CID 178039441 |
| PubChem CID | 178039441 |
| Molecular Formula | C13H19BN2O |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | — |
| SMILES | CC.[B]c1cnc(C2(OC)CC3(CC3)C2)nc1 |
| InChI | InChI=1S/C11H13BN2O.C2H6/c1-15-11(6-10(7-11)2-3-10)9-13-4-8(12)5-14-9;1-2/h4-5H,2-3,6-7H2,1H3;1-2H3 |
| InChIKey | OAKOSYGFFTWQOJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178039441 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178039441?
The IUPAC name of CID 178039441 (CID 178039441) is not available.
What is the SMILES notation for CID 178039441?
The canonical SMILES for CID 178039441 is CC.[B]c1cnc(C2(OC)CC3(CC3)C2)nc1.
What is the InChIKey of CID 178039441?
The InChIKey is OAKOSYGFFTWQOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BN2O.C2H6/c1-15-11(6-10(7-11)2-3-10)9-13-4-8(12)5-14-9;1-2/h4-5H,2-3,6-7H2,1H3;1-2H3.
What are the key properties of CID 178039441?
CID 178039441 has a molecular weight of 230.12 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178039441 is sourced from PubChem (CID 178039441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).