C16H30N2O5 — CID 178039786
tert-butyl N-[(2R)-3-cyclopropyl-1-[2,2-dimethoxyethyl(methyl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 178039786) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-cyclopropyl-1-[2,2-dimethoxyethyl(methyl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-cyclopropyl-1-[2,2-dimethoxyethyl(methyl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 178039786 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | tert-butyl N-[(2R)-3-cyclopropyl-1-[2,2-dimethoxyethyl(methyl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | COC(CN(C)C(=O)[C@@H](CC1CC1)NC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C16H30N2O5/c1-16(2,3)23-15(20)17-12(9-11-7-8-11)14(19)18(4)10-13(21-5)22-6/h11-13H,7-10H2,1-6H3,(H,17,20)/t12-/m1/s1 |
| InChIKey | QFPHBUDSQHMHME-GFCCVEGCSA-N |
| XLogP | 1.76 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|