C23H42N2O4S — CID 87823658
tert-butyl N-[(2R)-3-cyclohexyl-1-[(4-methoxycyclohexyl)methyl-methylsulfanylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 87823658) has the molecular formula C23H42N2O4S and a molecular weight of 442.67 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-cyclohexyl-1-[(4-methoxycyclohexyl)methyl-methylsulfanylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-cyclohexyl-1-[(4-methoxycyclohexyl)methyl-methylsulfanylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87823658 |
| Molecular Formula | C23H42N2O4S |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | tert-butyl N-[(2R)-3-cyclohexyl-1-[(4-methoxycyclohexyl)methyl-methylsulfanylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | COC1CCC(CN(SC)C(=O)[C@@H](CC2CCCCC2)NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H42N2O4S/c1-23(2,3)29-22(27)24-20(15-17-9-7-6-8-10-17)21(26)25(30-5)16-18-11-13-19(28-4)14-12-18/h17-20H,6-16H2,1-5H3,(H,24,27)/t18?,19?,20-/m1/s1 |
| InChIKey | VFNVGNXVYSQWKD-SOAGJPPSSA-N |
| XLogP | 5.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|