C27H43BN2O4 — CID 178039881
1-ethyl-3-(2-methylpropyl)-4-[3-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)benzoyl]piperazin-2-one (PubChem CID 178039881) has the molecular formula C27H43BN2O4 and a molecular weight of 470.46 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylpropyl)-4-[3-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)benzoyl]piperazin-2-one.
| Compound Name | 1-ethyl-3-(2-methylpropyl)-4-[3-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)benzoyl]piperazin-2-one |
|---|---|
| PubChem CID | 178039881 |
| Molecular Formula | C27H43BN2O4 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | 1-ethyl-3-(2-methylpropyl)-4-[3-(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)benzoyl]piperazin-2-one |
| SMILES | CCN1CCN(C(=O)c2cccc(B3OC(CC)(CC)C(CC)(CC)O3)c2)C(CC(C)C)C1=O |
| InChI | InChI=1S/C27H43BN2O4/c1-8-26(9-2)27(10-3,11-4)34-28(33-26)22-15-13-14-21(19-22)24(31)30-17-16-29(12-5)25(32)23(30)18-20(6)7/h13-15,19-20,23H,8-12,16-18H2,1-7H3 |
| InChIKey | XCOWDTRDSLZGCO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|