About ethane;propane;6-(trifluoromethoxy)pyridin-2-amine
ethane;propane;6-(trifluoromethoxy)pyridin-2-amine (PubChem CID 178040742) has the molecular formula C11H19F3N2O
and a molecular weight of 252.28 g/mol. Its IUPAC name is ethane;propane;6-(trifluoromethoxy)pyridin-2-amine.
Molecular Properties
| Compound Name | ethane;propane;6-(trifluoromethoxy)pyridin-2-amine |
| PubChem CID | 178040742 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | ethane;propane;6-(trifluoromethoxy)pyridin-2-amine |
| SMILES | CC.CCC.Nc1cccc(OC(F)(F)F)n1 |
| InChI | InChI=1S/C6H5F3N2O.C3H8.C2H6/c7-6(8,9)12-5-3-1-2-4(10)11-5;1-3-2;1-2/h1-3H,(H2,10,11);3H2,1-2H3;1-2H3 |
| InChIKey | BCGBUHOMLQHOHK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;propane;6-(trifluoromethoxy)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propane;6-(trifluoromethoxy)pyridin-2-amine?
The IUPAC name of ethane;propane;6-(trifluoromethoxy)pyridin-2-amine (CID 178040742) is ethane;propane;6-(trifluoromethoxy)pyridin-2-amine.
What is the SMILES notation for ethane;propane;6-(trifluoromethoxy)pyridin-2-amine?
The canonical SMILES for ethane;propane;6-(trifluoromethoxy)pyridin-2-amine is CC.CCC.Nc1cccc(OC(F)(F)F)n1.
What is the InChIKey of ethane;propane;6-(trifluoromethoxy)pyridin-2-amine?
The InChIKey is BCGBUHOMLQHOHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N2O.C3H8.C2H6/c7-6(8,9)12-5-3-1-2-4(10)11-5;1-3-2;1-2/h1-3H,(H2,10,11);3H2,1-2H3;1-2H3.
What are the key properties of ethane;propane;6-(trifluoromethoxy)pyridin-2-amine?
ethane;propane;6-(trifluoromethoxy)pyridin-2-amine has a molecular weight of 252.28 g/mol, XLogP of 4.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propane;6-(trifluoromethoxy)pyridin-2-amine is sourced from PubChem (CID 178040742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).