C24H25F4N5O3 — CID 178041844
5-[6-(3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl)-4-(1,1-difluoro-2-methylprop-2-enyl)-2-pyridinyl]-4-(1,1-difluoroethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one (PubChem CID 178041844) has the molecular formula C24H25F4N5O3 and a molecular weight of 507.49 g/mol. Its IUPAC name is 5-[6-(3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl)-4-(1,1-difluoro-2-methylprop-2-enyl)-2-pyridinyl]-4-(1,1-difluoroethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one.
| Compound Name | 5-[6-(3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl)-4-(1,1-difluoro-2-methylprop-2-enyl)-2-pyridinyl]-4-(1,1-difluoroethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 178041844 |
| Molecular Formula | C24H25F4N5O3 |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 5-[6-(3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl)-4-(1,1-difluoro-2-methylprop-2-enyl)-2-pyridinyl]-4-(1,1-difluoroethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
| SMILES | C=C(C)C(F)(F)c1cc(-c2ccnc3c2C(C(C)(F)F)OC(=O)N3)nc(N2CC3NCCOC3C2)c1 |
| InChI | InChI=1S/C24H25F4N5O3/c1-12(2)24(27,28)13-8-15(31-18(9-13)33-10-16-17(11-33)35-7-6-29-16)14-4-5-30-21-19(14)20(23(3,25)26)36-22(34)32-21/h4-5,8-9,16-17,20,29H,1,6-7,10-11H2,2-3H3,(H,30,32,34) |
| InChIKey | ZPLNUGFQPZIHSN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|