C8H6BF3N2O4 — CID 178042182
[(4R)-2-oxo-4-(trifluoromethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-5-yl]boronic acid (PubChem CID 178042182) has the molecular formula C8H6BF3N2O4 and a molecular weight of 261.95 g/mol. Its IUPAC name is [(4R)-2-oxo-4-(trifluoromethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-5-yl]boronic acid.
| Compound Name | [(4R)-2-oxo-4-(trifluoromethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-5-yl]boronic acid |
|---|---|
| PubChem CID | 178042182 |
| Molecular Formula | C8H6BF3N2O4 |
| Molecular Weight | 261.95 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | [(4R)-2-oxo-4-(trifluoromethyl)-1,4-dihydropyrido[2,3-d][1,3]oxazin-5-yl]boronic acid |
| SMILES | O=C1Nc2nccc(B(O)O)c2[C@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C8H6BF3N2O4/c10-8(11,12)5-4-3(9(16)17)1-2-13-6(4)14-7(15)18-5/h1-2,5,16-17H,(H,13,14,15)/t5-/m1/s1 |
| InChIKey | XETTYGMYRZTXSW-RXMQYKEDSA-N |
| XLogP | -0.07 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.95 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|