C13H20FN2O2P — CID 178041947
ethane;4-(1-fluoro-1-phosphanylpropyl)-5-methyl-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one (PubChem CID 178041947) has the molecular formula C13H20FN2O2P and a molecular weight of 286.29 g/mol. Its IUPAC name is ethane;4-(1-fluoro-1-phosphanylpropyl)-5-methyl-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one.
| Compound Name | ethane;4-(1-fluoro-1-phosphanylpropyl)-5-methyl-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 178041947 |
| Molecular Formula | C13H20FN2O2P |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | ethane;4-(1-fluoro-1-phosphanylpropyl)-5-methyl-1,4-dihydropyrido[2,3-d][1,3]oxazin-2-one |
| SMILES | CC.CCC(F)(P)C1OC(=O)Nc2nccc(C)c21 |
| InChI | InChI=1S/C11H14FN2O2P.C2H6/c1-3-11(12,17)8-7-6(2)4-5-13-9(7)14-10(15)16-8;1-2/h4-5,8H,3,17H2,1-2H3,(H,13,14,15);1-2H3 |
| InChIKey | SFRUDIYMFWCWIT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|