C10H8ClFN4 — CID 178043547
5-(4-chloro-2-fluorophenyl)-2-cyclopropyltetrazole (PubChem CID 178043547) has the molecular formula C10H8ClFN4 and a molecular weight of 238.65 g/mol. Its IUPAC name is 5-(4-chloro-2-fluorophenyl)-2-cyclopropyltetrazole.
| Compound Name | 5-(4-chloro-2-fluorophenyl)-2-cyclopropyltetrazole |
|---|---|
| PubChem CID | 178043547 |
| Molecular Formula | C10H8ClFN4 |
| Molecular Weight | 238.65 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 5-(4-chloro-2-fluorophenyl)-2-cyclopropyltetrazole |
| SMILES | Fc1cc(Cl)ccc1-c1nnn(C2CC2)n1 |
| InChI | InChI=1S/C10H8ClFN4/c11-6-1-4-8(9(12)5-6)10-13-15-16(14-10)7-2-3-7/h1,4-5,7H,2-3H2 |
| InChIKey | VMMPEVACIOGXKE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.65 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |