C32H37F2N7O2 — CID 178044171
(3S)-5-amino-3'-[4-(4,4-difluoropiperidin-1-yl)-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile (PubChem CID 178044171) has the molecular formula C32H37F2N7O2 and a molecular weight of 589.69 g/mol. Its IUPAC name is (3S)-5-amino-3'-[4-(4,4-difluoropiperidin-1-yl)-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile.
| Compound Name | (3S)-5-amino-3'-[4-(4,4-difluoropiperidin-1-yl)-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile |
|---|---|
| PubChem CID | 178044171 |
| Molecular Formula | C32H37F2N7O2 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | (3S)-5-amino-3'-[4-(4,4-difluoropiperidin-1-yl)-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile |
| SMILES | C[C@H](Oc1cc(N2CCC(F)(F)CC2)nc(-c2noc3c2CCC[C@@]32CCc3ccc(N)c(C#N)c32)n1)[C@@H]1CCCN1C |
| InChI | InChI=1S/C32H37F2N7O2/c1-19(24-6-4-14-40(24)2)42-26-17-25(41-15-12-32(33,34)13-16-41)37-30(38-26)28-21-5-3-10-31(29(21)43-39-28)11-9-20-7-8-23(36)22(18-35)27(20)31/h7-8,17,19,24H,3-6,9-16,36H2,1-2H3/t19-,24-,31-/m0/s1 |
| InChIKey | OHRPQFKSDBOZFE-XPAXXVQVSA-N |
| XLogP | 5.25 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|