C34H42N8O3 — CID 178044676
5-amino-3'-[4-(4,7-diazaspiro[2.5]octan-7-yl)-6-[1-(4-methoxy-1-methylpyrrolidin-2-yl)ethoxy]pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile (PubChem CID 178044676) has the molecular formula C34H42N8O3 and a molecular weight of 610.76 g/mol. Its IUPAC name is 5-amino-3'-[4-(4,7-diazaspiro[2.5]octan-7-yl)-6-[1-(4-methoxy-1-methylpyrrolidin-2-yl)ethoxy]pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile.
| Compound Name | 5-amino-3'-[4-(4,7-diazaspiro[2.5]octan-7-yl)-6-[1-(4-methoxy-1-methylpyrrolidin-2-yl)ethoxy]pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile |
|---|---|
| PubChem CID | 178044676 |
| Molecular Formula | C34H42N8O3 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | 5-amino-3'-[4-(4,7-diazaspiro[2.5]octan-7-yl)-6-[1-(4-methoxy-1-methylpyrrolidin-2-yl)ethoxy]pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile |
| SMILES | COC1CC(C(C)Oc2cc(N3CCNC4(CC4)C3)nc(-c3noc4c3CCCC43CCc4ccc(N)c(C#N)c43)n2)N(C)C1 |
| InChI | InChI=1S/C34H42N8O3/c1-20(26-15-22(43-3)18-41(26)2)44-28-16-27(42-14-13-37-33(19-42)11-12-33)38-32(39-28)30-23-5-4-9-34(31(23)45-40-30)10-8-21-6-7-25(36)24(17-35)29(21)34/h6-7,16,20,22,26,37H,4-5,8-15,18-19,36H2,1-3H3 |
| InChIKey | FENKJYBKVRUYNN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|