C33H40N8O3 — CID 178044809
5-amino-3'-[4-[1-(1-methylpyrrolidin-2-yl)ethoxy]-6-(2-oxa-5,8-diazaspiro[3.5]nonan-8-yl)pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile (PubChem CID 178044809) has the molecular formula C33H40N8O3 and a molecular weight of 596.74 g/mol. Its IUPAC name is 5-amino-3'-[4-[1-(1-methylpyrrolidin-2-yl)ethoxy]-6-(2-oxa-5,8-diazaspiro[3.5]nonan-8-yl)pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile.
| Compound Name | 5-amino-3'-[4-[1-(1-methylpyrrolidin-2-yl)ethoxy]-6-(2-oxa-5,8-diazaspiro[3.5]nonan-8-yl)pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile |
|---|---|
| PubChem CID | 178044809 |
| Molecular Formula | C33H40N8O3 |
| Molecular Weight | 596.74 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | 5-amino-3'-[4-[1-(1-methylpyrrolidin-2-yl)ethoxy]-6-(2-oxa-5,8-diazaspiro[3.5]nonan-8-yl)pyrimidin-2-yl]spiro[1,2-dihydroindene-3,7'-5,6-dihydro-4H-1,2-benzoxazole]-4-carbonitrile |
| SMILES | CC(Oc1cc(N2CCNC3(COC3)C2)nc(-c2noc3c2CCCC32CCc3ccc(N)c(C#N)c32)n1)C1CCCN1C |
| InChI | InChI=1S/C33H40N8O3/c1-20(25-6-4-13-40(25)2)43-27-15-26(41-14-12-36-32(17-41)18-42-19-32)37-31(38-27)29-22-5-3-10-33(30(22)44-39-29)11-9-21-7-8-24(35)23(16-34)28(21)33/h7-8,15,20,25,36H,3-6,9-14,17-19,35H2,1-2H3 |
| InChIKey | KTTJINLNLMXIRI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|