C35H39N7O2 — CID 178044898
6-amino-2-[3-[4-(1,3-dihydroisoindol-2-yl)-6-[(1S)-1-(1-methylpyrrolidin-2-yl)ethoxy]pyrimidin-2-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]-3-ethylbenzonitrile (PubChem CID 178044898) has the molecular formula C35H39N7O2 and a molecular weight of 589.74 g/mol. Its IUPAC name is 6-amino-2-[3-[4-(1,3-dihydroisoindol-2-yl)-6-[(1S)-1-(1-methylpyrrolidin-2-yl)ethoxy]pyrimidin-2-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]-3-ethylbenzonitrile.
| Compound Name | 6-amino-2-[3-[4-(1,3-dihydroisoindol-2-yl)-6-[(1S)-1-(1-methylpyrrolidin-2-yl)ethoxy]pyrimidin-2-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]-3-ethylbenzonitrile |
|---|---|
| PubChem CID | 178044898 |
| Molecular Formula | C35H39N7O2 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | 6-amino-2-[3-[4-(1,3-dihydroisoindol-2-yl)-6-[(1S)-1-(1-methylpyrrolidin-2-yl)ethoxy]pyrimidin-2-yl]-4,5,6,7-tetrahydro-1,2-benzoxazol-7-yl]-3-ethylbenzonitrile |
| SMILES | CCc1ccc(N)c(C#N)c1C1CCCc2c(-c3nc(O[C@@H](C)C4CCCN4C)cc(N4Cc5ccccc5C4)n3)noc21 |
| InChI | InChI=1S/C35H39N7O2/c1-4-22-14-15-28(37)27(18-36)32(22)25-11-7-12-26-33(40-44-34(25)26)35-38-30(42-19-23-9-5-6-10-24(23)20-42)17-31(39-35)43-21(2)29-13-8-16-41(29)3/h5-6,9-10,14-15,17,21,25,29H,4,7-8,11-13,16,19-20,37H2,1-3H3/t21-,25?,29?/m0/s1 |
| InChIKey | XUJVNSPDTPBBEK-GSYIRYNPSA-N |
| XLogP | 6.00 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|