C12H19N3O — CID 178044915
(3R)-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpiperidin-3-ol (PubChem CID 178044915) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is (3R)-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpiperidin-3-ol.
| Compound Name | (3R)-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 178044915 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (3R)-1-(2,6-dimethylpyrimidin-4-yl)-3-methylpiperidin-3-ol |
| SMILES | Cc1cc(N2CCC[C@@](C)(O)C2)nc(C)n1 |
| InChI | InChI=1S/C12H19N3O/c1-9-7-11(14-10(2)13-9)15-6-4-5-12(3,16)8-15/h7,16H,4-6,8H2,1-3H3/t12-/m1/s1 |
| InChIKey | PUYSTBCHJHRTPP-GFCCVEGCSA-N |
| XLogP | 1.44 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |