C11H18N2OS — CID 115871396
1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methylpiperidin-3-ol (PubChem CID 115871396) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methylpiperidin-3-ol.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 115871396 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-methylpiperidin-3-ol |
| SMILES | Cc1nc(N2CCCC(C)(O)C2)sc1C |
| InChI | InChI=1S/C11H18N2OS/c1-8-9(2)15-10(12-8)13-6-4-5-11(3,14)7-13/h14H,4-7H2,1-3H3 |
| InChIKey | GFKYQBONGDLYBY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |