C21H23ClFN5O2 — CID 178045105
7-amino-3-(4-chloro-2-ethoxyphenyl)-6-fluoro-2-(piperazin-1-ylmethyl)quinazolin-4-one (PubChem CID 178045105) has the molecular formula C21H23ClFN5O2 and a molecular weight of 431.90 g/mol. Its IUPAC name is 7-amino-3-(4-chloro-2-ethoxyphenyl)-6-fluoro-2-(piperazin-1-ylmethyl)quinazolin-4-one.
| Compound Name | 7-amino-3-(4-chloro-2-ethoxyphenyl)-6-fluoro-2-(piperazin-1-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 178045105 |
| Molecular Formula | C21H23ClFN5O2 |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 7-amino-3-(4-chloro-2-ethoxyphenyl)-6-fluoro-2-(piperazin-1-ylmethyl)quinazolin-4-one |
| SMILES | CCOc1cc(Cl)ccc1-n1c(CN2CCNCC2)nc2cc(N)c(F)cc2c1=O |
| InChI | InChI=1S/C21H23ClFN5O2/c1-2-30-19-9-13(22)3-4-18(19)28-20(12-27-7-5-25-6-8-27)26-17-11-16(24)15(23)10-14(17)21(28)29/h3-4,9-11,25H,2,5-8,12,24H2,1H3 |
| InChIKey | APPRRAZAYBVKLZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|