C30H34F2N2O4 — CID 178046982
4-[(6S)-7-[[5-(2-cyclopropyloxyethoxy)-7-methyl-1H-indol-4-yl]methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]benzoic acid (PubChem CID 178046982) has the molecular formula C30H34F2N2O4 and a molecular weight of 524.61 g/mol. Its IUPAC name is 4-[(6S)-7-[[5-(2-cyclopropyloxyethoxy)-7-methyl-1H-indol-4-yl]methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]benzoic acid.
| Compound Name | 4-[(6S)-7-[[5-(2-cyclopropyloxyethoxy)-7-methyl-1H-indol-4-yl]methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]benzoic acid |
|---|---|
| PubChem CID | 178046982 |
| Molecular Formula | C30H34F2N2O4 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 4-[(6S)-7-[[5-(2-cyclopropyloxyethoxy)-7-methyl-1H-indol-4-yl]methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]benzoic acid |
| SMILES | Cc1cc(OCCOC2CC2)c(CN2CCC3(C[C@H]2c2ccc(C(=O)O)cc2)CC(F)(F)C3)c2cc[nH]c12 |
| InChI | InChI=1S/C30H34F2N2O4/c1-19-14-26(38-13-12-37-22-6-7-22)24(23-8-10-33-27(19)23)16-34-11-9-29(17-30(31,32)18-29)15-25(34)20-2-4-21(5-3-20)28(35)36/h2-5,8,10,14,22,25,33H,6-7,9,11-13,15-18H2,1H3,(H,35,36)/t25-/m0/s1 |
| InChIKey | YFQWDSBROBLDCK-VWLOTQADSA-N |
| XLogP | 6.48 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|