C26H32F2N6O — CID 168994231
N,N'-diamino-4-[2,2-difluoro-7-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-azaspiro[3.5]nonan-6-yl]benzenecarboximidamide (PubChem CID 168994231) has the molecular formula C26H32F2N6O and a molecular weight of 482.58 g/mol. Its IUPAC name is N,N'-diamino-4-[2,2-difluoro-7-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-azaspiro[3.5]nonan-6-yl]benzenecarboximidamide.
| Compound Name | N,N'-diamino-4-[2,2-difluoro-7-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-azaspiro[3.5]nonan-6-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 168994231 |
| Molecular Formula | C26H32F2N6O |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N,N'-diamino-4-[2,2-difluoro-7-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-7-azaspiro[3.5]nonan-6-yl]benzenecarboximidamide |
| SMILES | COc1cc(C)c2[nH]ccc2c1CN1CCC2(CC1c1ccc(/C(=N/N)NN)cc1)CC(F)(F)C2 |
| InChI | InChI=1S/C26H32F2N6O/c1-16-11-22(35-2)20(19-7-9-31-23(16)19)13-34-10-8-25(14-26(27,28)15-25)12-21(34)17-3-5-18(6-4-17)24(32-29)33-30/h3-7,9,11,21,31H,8,10,12-15,29-30H2,1-2H3,(H,32,33) |
| InChIKey | WQWCJDBOSWJVMG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|