C28H32F2N6 — CID 168994210
4-[(6S)-7-[(5-cyclopropyl-7-methyl-1H-indol-4-yl)methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]-N'-diazenylbenzenecarboximidamide (PubChem CID 168994210) has the molecular formula C28H32F2N6 and a molecular weight of 490.60 g/mol. Its IUPAC name is 4-[(6S)-7-[(5-cyclopropyl-7-methyl-1H-indol-4-yl)methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]-N'-diazenylbenzenecarboximidamide.
| Compound Name | 4-[(6S)-7-[(5-cyclopropyl-7-methyl-1H-indol-4-yl)methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]-N'-diazenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 168994210 |
| Molecular Formula | C28H32F2N6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 4-[(6S)-7-[(5-cyclopropyl-7-methyl-1H-indol-4-yl)methyl]-2,2-difluoro-7-azaspiro[3.5]nonan-6-yl]-N'-diazenylbenzenecarboximidamide |
| SMILES | [H]/N=N/N=C(N)c1ccc([C@@H]2CC3(CCN2Cc2c(C4CC4)cc(C)c4[nH]ccc24)CC(F)(F)C3)cc1 |
| InChI | InChI=1S/C28H32F2N6/c1-17-12-22(18-2-3-18)23(21-8-10-33-25(17)21)14-36-11-9-27(15-28(29,30)16-27)13-24(36)19-4-6-20(7-5-19)26(31)34-35-32/h4-8,10,12,18,24,33H,2-3,9,11,13-16H2,1H3,(H3,31,32,34)/t24-/m0/s1 |
| InChIKey | MEZDLJRBRMOBNY-DEOSSOPVSA-N |
| XLogP | 6.76 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|