C29H43BN2O3 — CID 178049537
(2S)-2-amino-N-[(1R)-1-[(6S,8R)-5-ethyl-6,8-dimethyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3,2]dioxaborol-2-yl]-3-methylbutyl]-3-naphthalen-1-ylpropanamide (PubChem CID 178049537) has the molecular formula C29H43BN2O3 and a molecular weight of 478.49 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1R)-1-[(6S,8R)-5-ethyl-6,8-dimethyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3,2]dioxaborol-2-yl]-3-methylbutyl]-3-naphthalen-1-ylpropanamide.
| Compound Name | (2S)-2-amino-N-[(1R)-1-[(6S,8R)-5-ethyl-6,8-dimethyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3,2]dioxaborol-2-yl]-3-methylbutyl]-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 178049537 |
| Molecular Formula | C29H43BN2O3 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | (2S)-2-amino-N-[(1R)-1-[(6S,8R)-5-ethyl-6,8-dimethyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3,2]dioxaborol-2-yl]-3-methylbutyl]-3-naphthalen-1-ylpropanamide |
| SMILES | CCC1CC2OB([C@H](CC(C)C)NC(=O)[C@@H](N)Cc3cccc4ccccc34)OC2[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C29H43BN2O3/c1-6-21-17-26-28(20(5)15-19(21)4)35-30(34-26)27(14-18(2)3)32-29(33)25(31)16-23-12-9-11-22-10-7-8-13-24(22)23/h7-13,18-21,25-28H,6,14-17,31H2,1-5H3,(H,32,33)/t19-,20+,21?,25-,26?,27-,28?/m0/s1 |
| InChIKey | XBTBMFZFIYLOQP-BXFDUZORSA-N |
| XLogP | 5.14 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|