C23H36BClN2O3 — CID 163197226
(2S)-2-amino-N-[(1R)-1-[(1S,2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]-3-phenylpropanamide;hydrochloride (PubChem CID 163197226) has the molecular formula C23H36BClN2O3 and a molecular weight of 434.82 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1R)-1-[(1S,2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]-3-phenylpropanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[(1R)-1-[(1S,2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 163197226 |
| Molecular Formula | C23H36BClN2O3 |
| Molecular Weight | 434.82 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (2S)-2-amino-N-[(1R)-1-[(1S,2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-3-methylbutyl]-3-phenylpropanamide;hydrochloride |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)B1O[C@H]2[C@H]3C[C@@H](C[C@H]2O1)C3(C)C.Cl |
| InChI | InChI=1S/C23H35BN2O3.ClH/c1-14(2)10-20(26-22(27)18(25)11-15-8-6-5-7-9-15)24-28-19-13-16-12-17(21(19)29-24)23(16,3)4;/h5-9,14,16-21H,10-13,25H2,1-4H3,(H,26,27);1H/t16-,17+,18-,19+,20-,21-;/m0./s1 |
| InChIKey | RKDOLWMHRHDTGJ-KKPPAFHQSA-N |
| XLogP | 3.39 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.82 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|