C19H28BN2O3P — CID 143119881
N-[(9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]-3-phenyl-2-(phosphanylamino)propanamide (PubChem CID 143119881) has the molecular formula C19H28BN2O3P and a molecular weight of 374.23 g/mol. Its IUPAC name is N-[(9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]-3-phenyl-2-(phosphanylamino)propanamide.
| Compound Name | N-[(9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]-3-phenyl-2-(phosphanylamino)propanamide |
|---|---|
| PubChem CID | 143119881 |
| Molecular Formula | C19H28BN2O3P |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[(9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]-3-phenyl-2-(phosphanylamino)propanamide |
| SMILES | CC1(C)C2CC3OB(CNC(=O)C(Cc4ccccc4)NP)OC3C1C2 |
| InChI | InChI=1S/C19H28BN2O3P/c1-19(2)13-9-14(19)17-16(10-13)24-20(25-17)11-21-18(23)15(22-26)8-12-6-4-3-5-7-12/h3-7,13-17,22H,8-11,26H2,1-2H3,(H,21,23) |
| InChIKey | AOOXYXHDEHYWBK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|