C19H26BNO4 — CID 175051700
[2-phenyl-1-[(1S,2S,6R,8S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl] carbamate (PubChem CID 175051700) has the molecular formula C19H26BNO4 and a molecular weight of 343.23 g/mol. Its IUPAC name is [2-phenyl-1-[(1S,2S,6R,8S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl] carbamate.
| Compound Name | [2-phenyl-1-[(1S,2S,6R,8S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl] carbamate |
|---|---|
| PubChem CID | 175051700 |
| Molecular Formula | C19H26BNO4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [2-phenyl-1-[(1S,2S,6R,8S)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl] carbamate |
| SMILES | CC1(C)[C@H]2C[C@@H]1[C@@H]1OB(C(Cc3ccccc3)OC(N)=O)O[C@]1(C)C2 |
| InChI | InChI=1S/C19H26BNO4/c1-18(2)13-10-14(18)16-19(3,11-13)25-20(24-16)15(23-17(21)22)9-12-7-5-4-6-8-12/h4-8,13-16H,9-11H2,1-3H3,(H2,21,22)/t13-,14+,15?,16-,19+/m0/s1 |
| InChIKey | GBFHKUQPBUVGNA-MFBJYVJQSA-N |
| XLogP | 2.96 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|