C18H25BN4O3S — CID 123568256
N-[(1S)-2-azido-1-[(1R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-thiophen-2-ylacetamide (PubChem CID 123568256) has the molecular formula C18H25BN4O3S and a molecular weight of 388.30 g/mol. Its IUPAC name is N-[(1S)-2-azido-1-[(1R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(1S)-2-azido-1-[(1R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 123568256 |
| Molecular Formula | C18H25BN4O3S |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[(1S)-2-azido-1-[(1R,6S,8R)-6,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-2-thiophen-2-ylacetamide |
| SMILES | CC1(C)[C@@H]2C[C@H]1C1OB([C@@H](CN=[N+]=[N-])NC(=O)Cc3cccs3)O[C@@]1(C)C2 |
| InChI | InChI=1S/C18H25BN4O3S/c1-17(2)11-7-13(17)16-18(3,9-11)26-19(25-16)14(10-21-23-20)22-15(24)8-12-5-4-6-27-12/h4-6,11,13-14,16H,7-10H2,1-3H3,(H,22,24)/t11-,13+,14-,16?,18+/m1/s1 |
| InChIKey | RKTSSYHLXWWYTH-YXRHMLPASA-N |
| XLogP | 3.35 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|