C10H16O — CID 169187540
(1S,6S)-4,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane (PubChem CID 169187540) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (1S,6S)-4,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane.
| Compound Name | (1S,6S)-4,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane |
|---|---|
| PubChem CID | 169187540 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (1S,6S)-4,7,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane |
| SMILES | CC12C[C@@H]3C[C@H](C1O2)C3(C)C |
| InChI | InChI=1S/C10H16O/c1-9(2)6-4-7(9)8-10(3,5-6)11-8/h6-8H,4-5H2,1-3H3/t6-,7+,8?,10?/m0/s1 |
| InChIKey | IZYQQQMXLADHTJ-AYEHOMFDSA-N |
| XLogP | 2.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|