C29H38BN3O5S — CID 143963899
(2S)-N-[(1R)-2-cyclobutyl-1-[(1S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-phenyl-2-(pyridin-3-ylsulfonylamino)propanamide (PubChem CID 143963899) has the molecular formula C29H38BN3O5S and a molecular weight of 551.52 g/mol. Its IUPAC name is (2S)-N-[(1R)-2-cyclobutyl-1-[(1S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-phenyl-2-(pyridin-3-ylsulfonylamino)propanamide.
| Compound Name | (2S)-N-[(1R)-2-cyclobutyl-1-[(1S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-phenyl-2-(pyridin-3-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 143963899 |
| Molecular Formula | C29H38BN3O5S |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | (2S)-N-[(1R)-2-cyclobutyl-1-[(1S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethyl]-3-phenyl-2-(pyridin-3-ylsulfonylamino)propanamide |
| SMILES | CC1(C)[C@H]2C[C@@H]1C1OB([C@H](CC3CCC3)NC(=O)[C@H](Cc3ccccc3)NS(=O)(=O)c3cccnc3)O[C@@H]1C2 |
| InChI | InChI=1S/C29H38BN3O5S/c1-29(2)21-16-23(29)27-25(17-21)37-30(38-27)26(15-20-10-6-11-20)32-28(34)24(14-19-8-4-3-5-9-19)33-39(35,36)22-12-7-13-31-18-22/h3-5,7-9,12-13,18,20-21,23-27,33H,6,10-11,14-17H2,1-2H3,(H,32,34)/t21-,23+,24-,25+,26-,27?/m0/s1 |
| InChIKey | FRZIFTSPAUFLKX-PGIRAAEHSA-N |
| XLogP | 3.52 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|