C27H31BN2O6S — CID 59267346
[(1R)-2-cyclobutyl-1-[[(2S)-2-[(3-phenoxyphenyl)sulfonylamino]-3-phenylpropanoyl]amino]ethyl]boronic acid (PubChem CID 59267346) has the molecular formula C27H31BN2O6S and a molecular weight of 522.43 g/mol. Its IUPAC name is [(1R)-2-cyclobutyl-1-[[(2S)-2-[(3-phenoxyphenyl)sulfonylamino]-3-phenylpropanoyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-cyclobutyl-1-[[(2S)-2-[(3-phenoxyphenyl)sulfonylamino]-3-phenylpropanoyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 59267346 |
| Molecular Formula | C27H31BN2O6S |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | [(1R)-2-cyclobutyl-1-[[(2S)-2-[(3-phenoxyphenyl)sulfonylamino]-3-phenylpropanoyl]amino]ethyl]boronic acid |
| SMILES | O=C(N[C@@H](CC1CCC1)B(O)O)[C@H](Cc1ccccc1)NS(=O)(=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C27H31BN2O6S/c31-27(29-26(28(32)33)18-21-11-7-12-21)25(17-20-9-3-1-4-10-20)30-37(34,35)24-16-8-15-23(19-24)36-22-13-5-2-6-14-22/h1-6,8-10,13-16,19,21,25-26,30,32-33H,7,11-12,17-18H2,(H,29,31)/t25-,26-/m0/s1 |
| InChIKey | OZCSBIMSMBJUSE-UIOOFZCWSA-N |
| XLogP | 3.06 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|