C29H27ClN2O5S — CID 94863245
(2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(4-phenoxyphenyl)-3-phenylpropanamide (PubChem CID 94863245) has the molecular formula C29H27ClN2O5S and a molecular weight of 551.06 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(4-phenoxyphenyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(4-phenoxyphenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 94863245 |
| Molecular Formula | C29H27ClN2O5S |
| Molecular Weight | 551.06 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | (2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-(4-phenoxyphenyl)-3-phenylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C29H27ClN2O5S/c1-2-36-28-18-17-25(20-26(28)30)38(34,35)32-27(19-21-9-5-3-6-10-21)29(33)31-22-13-15-24(16-14-22)37-23-11-7-4-8-12-23/h3-18,20,27,32H,2,19H2,1H3,(H,31,33)/t27-/m1/s1 |
| InChIKey | WCRCVEFBMZRJRN-HHHXNRCGSA-N |
| XLogP | 6.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.06 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |