C27H25ClN2O4S — CID 30166236
(2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-naphthalen-1-yl-3-phenylpropanamide (PubChem CID 30166236) has the molecular formula C27H25ClN2O4S and a molecular weight of 509.03 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-naphthalen-1-yl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-naphthalen-1-yl-3-phenylpropanamide |
|---|---|
| PubChem CID | 30166236 |
| Molecular Formula | C27H25ClN2O4S |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (2R)-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-N-naphthalen-1-yl-3-phenylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)Nc2cccc3ccccc23)cc1Cl |
| InChI | InChI=1S/C27H25ClN2O4S/c1-2-34-26-16-15-21(18-23(26)28)35(32,33)30-25(17-19-9-4-3-5-10-19)27(31)29-24-14-8-12-20-11-6-7-13-22(20)24/h3-16,18,25,30H,2,17H2,1H3,(H,29,31)/t25-/m1/s1 |
| InChIKey | YEWRIVKEWJMPNC-RUZDIDTESA-N |
| XLogP | 5.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |