C25H29BN2O5S2 — CID 157469141
[(1R)-1-[[2-benzyl-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfonylpropanoyl]amino]-2-cyclopropylethyl]boronic acid (PubChem CID 157469141) has the molecular formula C25H29BN2O5S2 and a molecular weight of 512.46 g/mol. Its IUPAC name is [(1R)-1-[[2-benzyl-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfonylpropanoyl]amino]-2-cyclopropylethyl]boronic acid.
| Compound Name | [(1R)-1-[[2-benzyl-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfonylpropanoyl]amino]-2-cyclopropylethyl]boronic acid |
|---|---|
| PubChem CID | 157469141 |
| Molecular Formula | C25H29BN2O5S2 |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | [(1R)-1-[[2-benzyl-3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfonylpropanoyl]amino]-2-cyclopropylethyl]boronic acid |
| SMILES | Cc1nc(-c2cccc(S(=O)(=O)CC(Cc3ccccc3)C(=O)N[C@@H](CC3CC3)B(O)O)c2)cs1 |
| InChI | InChI=1S/C25H29BN2O5S2/c1-17-27-23(15-34-17)20-8-5-9-22(14-20)35(32,33)16-21(12-18-6-3-2-4-7-18)25(29)28-24(26(30)31)13-19-10-11-19/h2-9,14-15,19,21,24,30-31H,10-13,16H2,1H3,(H,28,29)/t21?,24-/m0/s1 |
| InChIKey | IHAKRPIYEKLNAM-FHZUCYEKSA-N |
| XLogP | 3.05 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|