C22H26BF2NO5S — CID 161464636
[(1R)-1-[[(2S)-2-benzyl-3-(2,5-difluorophenyl)sulfonylpropanoyl]amino]-2-cyclobutylethyl]boronic acid (PubChem CID 161464636) has the molecular formula C22H26BF2NO5S and a molecular weight of 465.33 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-benzyl-3-(2,5-difluorophenyl)sulfonylpropanoyl]amino]-2-cyclobutylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-benzyl-3-(2,5-difluorophenyl)sulfonylpropanoyl]amino]-2-cyclobutylethyl]boronic acid |
|---|---|
| PubChem CID | 161464636 |
| Molecular Formula | C22H26BF2NO5S |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [(1R)-1-[[(2S)-2-benzyl-3-(2,5-difluorophenyl)sulfonylpropanoyl]amino]-2-cyclobutylethyl]boronic acid |
| SMILES | O=C(N[C@@H](CC1CCC1)B(O)O)[C@H](Cc1ccccc1)CS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C22H26BF2NO5S/c24-18-9-10-19(25)20(13-18)32(30,31)14-17(11-15-5-2-1-3-6-15)22(27)26-21(23(28)29)12-16-7-4-8-16/h1-3,5-6,9-10,13,16-17,21,28-29H,4,7-8,11-12,14H2,(H,26,27)/t17-,21+/m1/s1 |
| InChIKey | WCGMTCIXAVZPDJ-UTKZUKDTSA-N |
| XLogP | 2.28 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|