C25H28BN3O6S — CID 77291075
[2-cyclopropyl-1-[[2-[(5-phenoxy-2-pyridinyl)sulfonylamino]-3-phenylpropanoyl]amino]ethyl]boronic acid (PubChem CID 77291075) has the molecular formula C25H28BN3O6S and a molecular weight of 509.39 g/mol. Its IUPAC name is [2-cyclopropyl-1-[[2-[(5-phenoxy-2-pyridinyl)sulfonylamino]-3-phenylpropanoyl]amino]ethyl]boronic acid.
| Compound Name | [2-cyclopropyl-1-[[2-[(5-phenoxy-2-pyridinyl)sulfonylamino]-3-phenylpropanoyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 77291075 |
| Molecular Formula | C25H28BN3O6S |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | [2-cyclopropyl-1-[[2-[(5-phenoxy-2-pyridinyl)sulfonylamino]-3-phenylpropanoyl]amino]ethyl]boronic acid |
| SMILES | O=C(NC(CC1CC1)B(O)O)C(Cc1ccccc1)NS(=O)(=O)c1ccc(Oc2ccccc2)cn1 |
| InChI | InChI=1S/C25H28BN3O6S/c30-25(28-23(26(31)32)16-19-11-12-19)22(15-18-7-3-1-4-8-18)29-36(33,34)24-14-13-21(17-27-24)35-20-9-5-2-6-10-20/h1-10,13-14,17,19,22-23,29,31-32H,11-12,15-16H2,(H,28,30) |
| InChIKey | WSKIKJIRPPUDRH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|