C17H39NO4S — CID 178050151
hydrogen peroxide;sulfanol;2,2,4-trimethyl-N-(2,3,3,4-tetramethylpentan-2-yl)pentanamide (PubChem CID 178050151) has the molecular formula C17H39NO4S and a molecular weight of 353.57 g/mol. Its IUPAC name is hydrogen peroxide;sulfanol;2,2,4-trimethyl-N-(2,3,3,4-tetramethylpentan-2-yl)pentanamide.
| Compound Name | hydrogen peroxide;sulfanol;2,2,4-trimethyl-N-(2,3,3,4-tetramethylpentan-2-yl)pentanamide |
|---|---|
| PubChem CID | 178050151 |
| Molecular Formula | C17H39NO4S |
| Molecular Weight | 353.57 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | hydrogen peroxide;sulfanol;2,2,4-trimethyl-N-(2,3,3,4-tetramethylpentan-2-yl)pentanamide |
| SMILES | CC(C)CC(C)(C)C(=O)NC(C)(C)C(C)(C)C(C)C.OO.OS |
| InChI | InChI=1S/C17H35NO.H2O2.H2OS/c1-12(2)11-15(5,6)14(19)18-17(9,10)16(7,8)13(3)4;2*1-2/h12-13H,11H2,1-10H3,(H,18,19);2*1-2H |
| InChIKey | YRMYKPQFVDGPDV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|