C14H27N3O4 — CID 18601643
(3S)-3-amino-4-oxo-4-[[(1R)-1-(2,2,4-trimethylpentanoylamino)ethyl]amino]butanoic acid (PubChem CID 18601643) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3S)-3-amino-4-oxo-4-[[(1R)-1-(2,2,4-trimethylpentanoylamino)ethyl]amino]butanoic acid.
| Compound Name | (3S)-3-amino-4-oxo-4-[[(1R)-1-(2,2,4-trimethylpentanoylamino)ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 18601643 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (3S)-3-amino-4-oxo-4-[[(1R)-1-(2,2,4-trimethylpentanoylamino)ethyl]amino]butanoic acid |
| SMILES | CC(C)CC(C)(C)C(=O)N[C@@H](C)NC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C14H27N3O4/c1-8(2)7-14(4,5)13(21)17-9(3)16-12(20)10(15)6-11(18)19/h8-10H,6-7,15H2,1-5H3,(H,16,20)(H,17,21)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | LQXZHFSHMGEXRF-UWVGGRQHSA-N |
| XLogP | 0.44 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|