C8H14NO3+ — CID 178050500
ethyl 1-hydroxy-2-methyl-3,4-dihydropyrrol-1-ium-2-carboxylate (PubChem CID 178050500) has the molecular formula C8H14NO3+ and a molecular weight of 172.20 g/mol. Its IUPAC name is ethyl 1-hydroxy-2-methyl-3,4-dihydropyrrol-1-ium-2-carboxylate.
| Compound Name | ethyl 1-hydroxy-2-methyl-3,4-dihydropyrrol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 178050500 |
| Molecular Formula | C8H14NO3+ |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | ethyl 1-hydroxy-2-methyl-3,4-dihydropyrrol-1-ium-2-carboxylate |
| SMILES | CCOC(=O)C1(C)CCC=[N+]1O |
| InChI | InChI=1S/C8H14NO3/c1-3-12-7(10)8(2)5-4-6-9(8)11/h6,11H,3-5H2,1-2H3/q+1 |
| InChIKey | WOFSRGUABMNUNC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|