C26H28FIN5O5P — CID 178051649
N-[5-[5-[3-(2-fluoroethoxy)cyclobutyl]-1,2,4-oxadiazol-3-yl]-2-methylphenyl]-7-(2-iodophosphanyloxyethoxymethyl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 178051649) has the molecular formula C26H28FIN5O5P and a molecular weight of 667.42 g/mol. Its IUPAC name is N-[5-[5-[3-(2-fluoroethoxy)cyclobutyl]-1,2,4-oxadiazol-3-yl]-2-methylphenyl]-7-(2-iodophosphanyloxyethoxymethyl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[5-[5-[3-(2-fluoroethoxy)cyclobutyl]-1,2,4-oxadiazol-3-yl]-2-methylphenyl]-7-(2-iodophosphanyloxyethoxymethyl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 178051649 |
| Molecular Formula | C26H28FIN5O5P |
| Molecular Weight | 667.42 g/mol |
| Exact Mass | 667.09 |
| IUPAC Name | N-[5-[5-[3-(2-fluoroethoxy)cyclobutyl]-1,2,4-oxadiazol-3-yl]-2-methylphenyl]-7-(2-iodophosphanyloxyethoxymethyl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccc(-c2noc(C3CC(OCCF)C3)n2)cc1NC(=O)c1cnc2cc(COCCOPI)ccn12 |
| InChI | InChI=1S/C26H28FIN5O5P/c1-16-2-3-18(24-31-26(38-32-24)19-11-20(12-19)36-7-5-27)13-21(16)30-25(34)22-14-29-23-10-17(4-6-33(22)23)15-35-8-9-37-39-28/h2-4,6,10,13-14,19-20,39H,5,7-9,11-12,15H2,1H3,(H,30,34) |
| InChIKey | HIHWJNPOGVDXDF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|