C9H7Cl3N4O — CID 178051855
3-methyl-6-[5-(trichloromethyl)-1,2,4-oxadiazol-3-yl]pyridin-2-amine (PubChem CID 178051855) has the molecular formula C9H7Cl3N4O and a molecular weight of 293.54 g/mol. Its IUPAC name is 3-methyl-6-[5-(trichloromethyl)-1,2,4-oxadiazol-3-yl]pyridin-2-amine.
| Compound Name | 3-methyl-6-[5-(trichloromethyl)-1,2,4-oxadiazol-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 178051855 |
| Molecular Formula | C9H7Cl3N4O |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 3-methyl-6-[5-(trichloromethyl)-1,2,4-oxadiazol-3-yl]pyridin-2-amine |
| SMILES | Cc1ccc(-c2noc(C(Cl)(Cl)Cl)n2)nc1N |
| InChI | InChI=1S/C9H7Cl3N4O/c1-4-2-3-5(14-6(4)13)7-15-8(17-16-7)9(10,11)12/h2-3H,1H3,(H2,13,14) |
| InChIKey | ACICMYQAHWBPJO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|