C7H4ClF2N3OS — CID 165392196
5-[chloro(difluoro)methyl]-3-(2-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole (PubChem CID 165392196) has the molecular formula C7H4ClF2N3OS and a molecular weight of 251.65 g/mol. Its IUPAC name is 5-[chloro(difluoro)methyl]-3-(2-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 5-[chloro(difluoro)methyl]-3-(2-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 165392196 |
| Molecular Formula | C7H4ClF2N3OS |
| Molecular Weight | 251.65 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | 5-[chloro(difluoro)methyl]-3-(2-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole |
| SMILES | Cc1ncc(-c2noc(C(F)(F)Cl)n2)s1 |
| InChI | InChI=1S/C7H4ClF2N3OS/c1-3-11-2-4(15-3)5-12-6(14-13-5)7(8,9)10/h2H,1H3 |
| InChIKey | MVCVTKGQHLYKNW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.65 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|